CAS 2419-38-7 appears in our catalog under these names: Pht-Leu-OH, 98%, Phthaloyl–Leu–OH, Pht-Leu-OH, >95.0%(HPLC)(T), Pht-Leu-OH 98%, (S)-2-(1,3-Dioxoisoindolin-2-yl)-4-methylpentanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 250g, 500g.
(2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid (CAS 2419-38-7) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid. InChIKey: RMOSZIHTPMEZAP-NSHDSACASA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoic acid |
| InChIKey | RMOSZIHTPMEZAP-NSHDSACASA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)