CAS 134575-15-8 appears in our catalog under these names: Exo-3-cbz-3-azabicyclo[3.1.0]hexane-6-carboxylic acid, 95%, exo-3-((Benzyloxy)carbonyl)-3-azabicyclo(3.1.0)hexane-6-carboxylic acid, 97%, Exo-3-cbz-3-azabicyclo(3.1.0)hexane-6-carboxylic Acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 250mg, 10g, 100mg.
(1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS 134575-15-8) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: ICSLZBSYUJAPNS-FOSCPWQOSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (1R,5S)-3-phenylmethoxycarbonyl-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | ICSLZBSYUJAPNS-FOSCPWQOSA-N |
| SMILES | C1[C@@H]2[C@@H](C2C(=O)O)CN1C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)