1,3-Dioxoisoindolin-2-yl 3,3-dimethylbutanoate, 97%
cas: 1894176-78-3 — see every product listed under this CAS number, including other names
1,3-Dioxoisoindolin-2-yl 3,3-dimethylbutanoate, 97% (CAS 1894176-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1496193-250mg |
| cas | 1894176-78-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1099.06 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 392.11 Pln | |
| BLDpharm | 5g | 1175.17 Pln | |
| BLDpharm | 10g | 1874.92 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 25g | 1950.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1,3-dioxoisoindol-2-yl) 3,3-dimethylbutanoate (CAS 1894176-78-3) is a chemical compound with the molecular formula C14H15NO4 and a molecular weight of 261.27 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 3,3-dimethylbutanoate. InChIKey: DUSMTZBBCUVXEZ-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 3,3-dimethylbutanoate |
| InChIKey | DUSMTZBBCUVXEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)
