cas: 1533-20-6 — see every product listed under this CAS number, including other names
1,3-Diphenyl-1-butanone (CAS 1533-20-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F341868-250MG |
| cas | 1533-20-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 1060.06 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-diphenylbutan-1-one (CAS 1533-20-6) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 1,3-diphenylbutan-1-one. InChIKey: GIVFXLVPKFXTCU-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1,3-diphenylbutan-1-one |
| InChIKey | GIVFXLVPKFXTCU-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)