1,3-Diphenyl-1H-pyrazole-5-carboxylic acid, 98%, 98%
cas: 964-42-1 — see every product listed under this CAS number, including other names
1,3-Diphenyl-1H-pyrazole-5-carboxylic acid, 98%, 98% (CAS 964-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116UKY-100mg |
| cas | 964-42-1 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 381.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-diphenylpyrazole-5-carboxylic acid (CAS 964-42-1) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1,3-diphenylpyrazole-5-carboxylic acid. InChIKey: QRARAAONIFSAIX-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-5-carboxylic acid |
| InChIKey | QRARAAONIFSAIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
1,3-diphenyl-1H-pyrazole-5-carboxylic acid, 2,5-Diphenyl-2H-pyrazole-3-carboxylic acid, 2,5-diphenylpyrazole-3-carboxylic Acid, 1,3-diphenylpyrazole-5-carboxylic acid, 1H-Pyrazole-5-carboxylic acid, 1,3-diphenyl-, Cambridge id 5107746, 2,5-di(phenyl)-3-pyrazolecarboxylic acid, 2,5-di(phenyl)pyrazole-3-carboxylic acid, 1,3-diphenyl-1H-pyrazole-5-carboxylicacid, 1,3-Diphenyl-1H-pyrazole-5-carboxylic acid - [D94467]