CAS 77169-12-1 appears in our catalog under these names: 1,3-Diphenyl-1H-pyrazole-4-carboxylic acid, 95%, 1,3-Diphenyl-1H-pyrazole-4-carboxylic acid, 97%, 1,3-Diphenyl-1H-pyrazole-4-carboxylic acid, 95%, 95%, 1,3-Diphenyl-1 H -pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
1,3-diphenylpyrazole-4-carboxylic acid (CAS 77169-12-1) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1,3-diphenylpyrazole-4-carboxylic acid. InChIKey: OTDDCLPBNWLJLH-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-4-carboxylic acid |
| InChIKey | OTDDCLPBNWLJLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)