CAS 1246040-90-3 appears in our catalog under these names: 5H-Indolo[2,1-c][1,4]benzodiazepine-6,12(5ah,7h)-dione, 95%, 5H-Indolo(2,1-c)(1,4)benzodiazepine-6,12(5aH,7H)-dione. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
12a,13-dihydro-11H-indolo[2,1-c][1,4]benzodiazepine-6,12-dione (CAS 1246040-90-3) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 12a,13-dihydro-11H-indolo[2,1-c][1,4]benzodiazepine-6,12-dione. InChIKey: WPDQTUIEHQISKR-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 12a,13-dihydro-11H-indolo[2,1-c][1,4]benzodiazepine-6,12-dione |
| InChIKey | WPDQTUIEHQISKR-UHFFFAOYSA-N |
| SMILES | C1C2C(=O)NC3=CC=CC=C3C(=O)N2C4=CC=CC=C41 |
Computed by PubChem (NCBI)