CAS 49811-67-8 is the registry number for 3-Phenyl-1-(phenylamino)-2,5-dihydro-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-anilino-3-phenylpyrrole-2,5-dione (CAS 49811-67-8) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1-anilino-3-phenylpyrrole-2,5-dione. InChIKey: SLDRBJYQYWWNTB-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1-anilino-3-phenylpyrrole-2,5-dione |
| InChIKey | SLDRBJYQYWWNTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)N(C2=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)