CAS 107027-42-9 is the registry number for 8-Methyl-2-pyridin-4-ylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid (CAS 107027-42-9) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid. InChIKey: KLSIJLUVNKNDFJ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid |
| InChIKey | KLSIJLUVNKNDFJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=NC=C3)C(=O)O |
Computed by PubChem (NCBI)