CAS 964-42-1 appears in our catalog under these names: 1,3-Diphenyl-1h-pyrazole-5-carboxylic acid, 98%, 2,5-Diphenyl-2H-pyrazole-3-carboxylic acid, 1,3-Diphenyl-1H-pyrazole-5-carboxylic acid 98%, 1,3-Diphenyl-1H-pyrazole-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 1000mg, 500mg, 2000mg, 100mg.
1,3-diphenylpyrazole-5-carboxylic acid (CAS 964-42-1) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1,3-diphenylpyrazole-5-carboxylic acid. InChIKey: QRARAAONIFSAIX-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1,3-diphenylpyrazole-5-carboxylic acid |
| InChIKey | QRARAAONIFSAIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)