cas: 6488-59-1 — see every product listed under this CAS number, including other names
1,3-Diphenylparabanic acid, 95% (CAS 6488-59-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A759279-10g |
| cas | 6488-59-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4125.73 Pln | |
| AmBeed | 25g | 10206.07 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-diphenylimidazolidine-2,4,5-trione (CAS 6488-59-1) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 1,3-diphenylimidazolidine-2,4,5-trione. InChIKey: WVFNUIVPEBYSNN-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1,3-diphenylimidazolidine-2,4,5-trione |
| InChIKey | WVFNUIVPEBYSNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=O)N(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)