Products 60510-51-2
CAS 60510-51-2 is the registry number for 2-(3-Phenyl-1,2,4-oxadiazol-5-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzoic acid (CAS 60510-51-2) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzoic acid. InChIKey: LQGDDSTWIZEWAR-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| InChIKey | LQGDDSTWIZEWAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)