CAS 956769-55-4 is the registry number for 3-(5-Formyl-2-furyl)-1-phenyl-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(5-formylfuran-2-yl)-1-phenylpyrazole-4-carbaldehyde (CAS 956769-55-4) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 3-(5-formylfuran-2-yl)-1-phenylpyrazole-4-carbaldehyde. InChIKey: CCOHCERQPKBHQX-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3-(5-formylfuran-2-yl)-1-phenylpyrazole-4-carbaldehyde |
| InChIKey | CCOHCERQPKBHQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(O3)C=O)C=O |
Computed by PubChem (NCBI)