CAS 354120-96-0 is the registry number for 6-(3-Acetylphenyl)-5h-pyrrolo[3,4-b]pyridine-5,7(6h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-(3-acetylphenyl)pyrrolo[3,4-b]pyridine-5,7-dione (CAS 354120-96-0) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 6-(3-acetylphenyl)pyrrolo[3,4-b]pyridine-5,7-dione. InChIKey: UNBYRRRFRXRQPW-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 6-(3-acetylphenyl)pyrrolo[3,4-b]pyridine-5,7-dione |
| InChIKey | UNBYRRRFRXRQPW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2C(=O)C3=C(C2=O)N=CC=C3 |
Computed by PubChem (NCBI)