CAS 36412-08-5 is the registry number for (3Z)-1-Phenylquinoline-2,3,4(1h)-trione 3-oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-hydroxy-3-nitroso-1-phenylquinolin-2-one (CAS 36412-08-5) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 4-hydroxy-3-nitroso-1-phenylquinolin-2-one. InChIKey: YLVMFMIISDSSJQ-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-hydroxy-3-nitroso-1-phenylquinolin-2-one |
| InChIKey | YLVMFMIISDSSJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C(=C(C2=O)N=O)O |
Computed by PubChem (NCBI)