CAS 6488-59-1 appears in our catalog under these names: 1,3-Diphenylimidazolidine-2,4,5-trione, 95%, 1,3-Diphenylparabanic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.
1,3-diphenylimidazolidine-2,4,5-trione (CAS 6488-59-1) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 1,3-diphenylimidazolidine-2,4,5-trione. InChIKey: WVFNUIVPEBYSNN-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1,3-diphenylimidazolidine-2,4,5-trione |
| InChIKey | WVFNUIVPEBYSNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C(=O)N(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)