cas: 2437-08-3 — see every product listed under this CAS number, including other names
1,3-dihydro-2H-indene-2,2-dicarboxylic acid (CAS 2437-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F373625-1G |
| cas | 2437-08-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1382.86 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-dihydroindene-2,2-dicarboxylic acid (CAS 2437-08-3) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 1,3-dihydroindene-2,2-dicarboxylic acid. InChIKey: RYGAENQWIQPFAI-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1,3-dihydroindene-2,2-dicarboxylic acid |
| InChIKey | RYGAENQWIQPFAI-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)