CAS 20577-73-5 appears in our catalog under these names: Methyl 2,4-dioxo-4-phenylbutanoate, 98%, Methyl 2,4-dioxo-4-phenylbutanoate, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg.
Methyl 2,4-dioxo-4-phenylbutanoate (CAS 20577-73-5) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: methyl 2,4-dioxo-4-phenylbutanoate. InChIKey: AQYAHPDSJAFBOS-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-phenylbutanoate |
| InChIKey | AQYAHPDSJAFBOS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)