1,4-Bis(4-methoxyphenyl)buta-1,3-diyne, 98%
cas: 22779-05-1 — see every product listed under this CAS number, including other names
1,4-Bis(4-methoxyphenyl)buta-1,3-diyne, 98% (CAS 22779-05-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1928670-250mg |
| cas | 22779-05-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 770.88 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2434.06 Pln | |
| Ambeed | 100g | 7623.88 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 825.29 Pln | |
| BLDpharm | 10g | 1469.51 Pln | |
| BLDpharm | 25g | 2619.10 Pln | |
| BLDpharm | 100g | 8217.13 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-diynyl]benzene (CAS 22779-05-1) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: 1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-diynyl]benzene. InChIKey: GXEAUSITYGYUDM-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-diynyl]benzene |
| InChIKey | GXEAUSITYGYUDM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C#CC#CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)