Products 32468-70-5
CAS 32468-70-5 appears in our catalog under these names: 9-Anthryl methacrylate, 95%, Anthracen-9-yl methacrylate, 97%, 9–Anthryl methacrylate, 9-Anthryl methacrylate, Anthracen-9-yl methacrylate, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 50mg, 1000mg, 500mg, 2000mg.
Anthracen-9-yl 2-methylprop-2-enoate (CAS 32468-70-5) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: anthracen-9-yl 2-methylprop-2-enoate. InChIKey: OZFRHFIPBWCCMP-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | anthracen-9-yl 2-methylprop-2-enoate |
| InChIKey | OZFRHFIPBWCCMP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=C2C=CC=CC2=CC3=CC=CC=C31 |
Computed by PubChem (NCBI)