CAS 904688-59-1 is the registry number for Methyl 6-phenyl-2-naphthoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
Methyl 6-phenylnaphthalene-2-carboxylate (CAS 904688-59-1) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: methyl 6-phenylnaphthalene-2-carboxylate. InChIKey: ZVPJBLRISSXOBJ-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | methyl 6-phenylnaphthalene-2-carboxylate |
| InChIKey | ZVPJBLRISSXOBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)