Products 904688-59-1

CAS 904688-59-1 is the registry number for Methyl 6-phenyl-2-naphthoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

Methyl 6-phenylnaphthalene-2-carboxylate (CAS 904688-59-1) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: methyl 6-phenylnaphthalene-2-carboxylate. InChIKey: ZVPJBLRISSXOBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O2
Molecular weight262.3 g/mol
IUPAC namemethyl 6-phenylnaphthalene-2-carboxylate
InChIKeyZVPJBLRISSXOBJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)