CAS 213455-52-8 appears in our catalog under these names: 4-Benzyloxynaphthalene-1-carboxaldehyde, 95%, 4-(Benzyloxy)-1-naphthaldehyde, 98%, 4-Benzyloxynaphthalene-1-carboxaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-phenylmethoxynaphthalene-1-carbaldehyde (CAS 213455-52-8) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: 4-phenylmethoxynaphthalene-1-carbaldehyde. InChIKey: VXVHJLATONZLDT-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 4-phenylmethoxynaphthalene-1-carbaldehyde |
| InChIKey | VXVHJLATONZLDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C3=CC=CC=C32)C=O |
Computed by PubChem (NCBI)