CAS 20399-92-2 is the registry number for 10,11-Dihydro-9H-benzo[a]xanthene-8-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
10,11-dihydro-9H-benzo[a]xanthene-8-carbaldehyde (CAS 20399-92-2) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: 10,11-dihydro-9H-benzo[a]xanthene-8-carbaldehyde. InChIKey: ZDGUCOSTWQXSPJ-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 10,11-dihydro-9H-benzo[a]xanthene-8-carbaldehyde |
| InChIKey | ZDGUCOSTWQXSPJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C=CC4=CC=CC=C43)OC2=C(C1)C=O |
Computed by PubChem (NCBI)