Products 1396174-02-9

CAS 1396174-02-9 is the registry number for 3-Phenyl-3,4-dihydrodibenzo(b,d)furan-1(2H)-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-phenyl-3,4-dihydro-2H-dibenzofuran-1-one (CAS 1396174-02-9) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: 3-phenyl-3,4-dihydro-2H-dibenzofuran-1-one. InChIKey: YSPMZUOLESFGCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O2
Molecular weight262.3 g/mol
IUPAC name3-phenyl-3,4-dihydro-2H-dibenzofuran-1-one
InChIKeyYSPMZUOLESFGCZ-UHFFFAOYSA-N
SMILESC1C(CC(=O)C2=C1OC3=CC=CC=C32)C4=CC=CC=C4

Computed by PubChem (NCBI)