cas: 64728-49-0 — see every product listed under this CAS number, including other names
1,4-Di(pyridin-2-yl)piperazine 97% (CAS 64728-49-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A275910-250mg |
| cas | 64728-49-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 1939.00 Pln | |
| Ambeed | 5g | 5677.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A275910 |
1,4-dipyridin-2-ylpiperazine (CAS 64728-49-0) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 1,4-dipyridin-2-ylpiperazine. InChIKey: GMNOIEBLHFKZLT-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,4-dipyridin-2-ylpiperazine |
| InChIKey | GMNOIEBLHFKZLT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)