cas: 1205-91-0 — see every product listed under this CAS number, including other names
1,4-Diacetoxybenzene, >98.0%(GC) (CAS 1205-91-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1803-25G |
| cas | 1205-91-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 108.51 Pln | |
| TCI | 500g | 836.26 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
(4-acetyloxyphenyl) acetate (CAS 1205-91-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (4-acetyloxyphenyl) acetate. InChIKey: AKOGNYJNGMLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (4-acetyloxyphenyl) acetate |
| InChIKey | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)