cas: 1205-91-0 — see every product listed under this CAS number, including other names
1,4-Phenylene diacetate, 98%, 98% (CAS 1205-91-0) is a chemical reagent available from Chemat. Available pack sizes: 250g, 5g, 10g, 15g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B1K-250g |
| cas | 1205-91-0 |
| size | 250g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 496.40 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 15g | 107.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 50g | 155.60 Pln | |
| Chemat | 100g | 246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-acetyloxyphenyl) acetate (CAS 1205-91-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (4-acetyloxyphenyl) acetate. InChIKey: AKOGNYJNGMLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (4-acetyloxyphenyl) acetate |
| InChIKey | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)