cas: 1205-91-0 — see every product listed under this CAS number, including other names
Hydroquinone diacetate, 98.30% (CAS 1205-91-0) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 5 mg, 10 mg, 100 mg, 50 mg, 25 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-118292-10mM/1mL |
| cas | 1205-91-0 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 5 mg | 263.96 Pln | |
| MedChemExpress | 10 mg | 310.40 Pln | |
| MedChemExpress | 100 mg | 598.33 Pln | |
| MedChemExpress | 50 mg | 505.45 Pln | |
| MedChemExpress | 25 mg | 407.93 Pln | |
| MedChemExpress | 1 g | 793.38 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.30% |
(4-acetyloxyphenyl) acetate (CAS 1205-91-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (4-acetyloxyphenyl) acetate. InChIKey: AKOGNYJNGMLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (4-acetyloxyphenyl) acetate |
| InChIKey | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)