1,5-Dichloro-2-fluoro-3-nitrobenzene, 98%
cas: 501644-37-7 — see every product listed under this CAS number, including other names
1,5-Dichloro-2-fluoro-3-nitrobenzene, 98% (CAS 501644-37-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A861596-100mg |
| cas | 501644-37-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1043.44 Pln | |
| Ambeed | 5g | 3490.94 Pln | |
| Ambeed | 10g | 6249.94 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1119.63 Pln | |
| BLDpharm | 5g | 3763.14 Pln | |
| BLDpharm | 10g | 6734.32 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1077.20 Pln | |
| Chemat | 5g | 3616.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,5-dichloro-2-fluoro-3-nitrobenzene (CAS 501644-37-7) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,5-dichloro-2-fluoro-3-nitrobenzene. InChIKey: UTMYBNIUMQLFSK-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,5-dichloro-2-fluoro-3-nitrobenzene |
| InChIKey | UTMYBNIUMQLFSK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Cl)Cl |
Computed by PubChem (NCBI)
