1,5-Diphenyl-1H-pyrazole-3-carboxylic acid
cas: 13599-22-9 — see every product listed under this CAS number, including other names
1,5-Diphenyl-1H-pyrazole-3-carboxylic acid (CAS 13599-22-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 1g, 5mg, 10mg. Offered by: Biosynth, Chemat, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FD56405-100mg |
| cas | 13599-22-9 |
| size | 100mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 100mg | price on request | |
| Biosynth | 50mg | price on request | |
| Biosynth | 250mg | price on request | |
| Biosynth | 500mg | price on request | |
| Biosynth | 1000mg | price on request | |
| Chemat | 50mg | 251.60 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| Chemat | 5mg | 179.60 Pln | |
| Chemat | 10mg | 237.20 Pln | |
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 50mg | 388.42 Pln | |
| Fluorochem | 250mg | 778.91 Pln | |
| Fluorochem | 1g | 2424.16 Pln |
properties
| category | Controlled Products |
|---|---|
| purity | No data |
| delivery time | 3-4 Weeks |
1,5-diphenylpyrazole-3-carboxylic acid (CAS 13599-22-9) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1,5-diphenylpyrazole-3-carboxylic acid. InChIKey: JJMZLVASVSISLC-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1,5-diphenylpyrazole-3-carboxylic acid |
| InChIKey | JJMZLVASVSISLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)