Products 6263-83-8
CAS 6263-83-8 appears in our catalog under these names: 1，5–Diphenylpentane–1，5–dione, 1,5-Diphenyl-1,5-pentanedione, 99%, 1,5-Diphenylpentane-1,5-dione, 98%, 98%, 1,3-DIBENZOYLPROPANE, 98%, 1,5-Diphenyl-1,5-pentanedione. Offered by: GLPBio, Thermo Scientific (Acros), Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 250mg, 10g, 100mg, 1g, 5g, 25g.
1,5-diphenylpentane-1,5-dione (CAS 6263-83-8) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 1,5-diphenylpentane-1,5-dione. InChIKey: YOLLTWVIOASMFW-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1,5-diphenylpentane-1,5-dione |
| InChIKey | YOLLTWVIOASMFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCCC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)