CAS 1528793-26-1 is the registry number for 3-(tert-Butyl)-6H-benzo(c)chromen-6-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
3-tert-butylbenzo[c]chromen-6-one (CAS 1528793-26-1) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 3-tert-butylbenzo[c]chromen-6-one. InChIKey: FHTFANTVAFMPCT-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 3-tert-butylbenzo[c]chromen-6-one |
| InChIKey | FHTFANTVAFMPCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)