CAS 688753-79-9 appears in our catalog under these names: 2,7-Diformyl-1,8-naphthalenediol, 2,7-Diformyl-1,8-Naphthalenediol, 97%, 97%, 1,8-Dihydroxynaphthalene-2,7-dicarbaldehyde, 97%. Offered by: TRC, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
1,8-dihydroxynaphthalene-2,7-dicarbaldehyde (CAS 688753-79-9) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: 1,8-dihydroxynaphthalene-2,7-dicarbaldehyde. InChIKey: UDYLQFQXKPHCBV-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 1,8-dihydroxynaphthalene-2,7-dicarbaldehyde |
| InChIKey | UDYLQFQXKPHCBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CC(=C2O)C=O)O)C=O |
Computed by PubChem (NCBI)