CAS 200712-25-0 is the registry number for 2H-Naphtho[2,3-d][1,3]dioxole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzo[f][1,3]benzodioxole-2-carboxylic acid (CAS 200712-25-0) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: benzo[f][1,3]benzodioxole-2-carboxylic acid. InChIKey: VVXREWCOUSRUAO-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | benzo[f][1,3]benzodioxole-2-carboxylic acid |
| InChIKey | VVXREWCOUSRUAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)OC(O3)C(=O)O |
Computed by PubChem (NCBI)