Products 200712-25-0

CAS 200712-25-0 is the registry number for 2H-Naphtho[2,3-d][1,3]dioxole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzo[f][1,3]benzodioxole-2-carboxylic acid (CAS 200712-25-0) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: benzo[f][1,3]benzodioxole-2-carboxylic acid. InChIKey: VVXREWCOUSRUAO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8O4
Molecular weight216.19 g/mol
IUPAC namebenzo[f][1,3]benzodioxole-2-carboxylic acid
InChIKeyVVXREWCOUSRUAO-UHFFFAOYSA-N
SMILESC1=CC=C2C=C3C(=CC2=C1)OC(O3)C(=O)O

Computed by PubChem (NCBI)