Products 1083-01-8

CAS 1083-01-8 is the registry number for 4-Oxo-6-phenyl-4H-pyran-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-oxo-6-phenylpyran-2-carboxylic acid (CAS 1083-01-8) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: 4-oxo-6-phenylpyran-2-carboxylic acid. InChIKey: ZBLMDHRGZBRWNO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8O4
Molecular weight216.19 g/mol
IUPAC name4-oxo-6-phenylpyran-2-carboxylic acid
InChIKeyZBLMDHRGZBRWNO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=O)C=C(O2)C(=O)O

Computed by PubChem (NCBI)