Products 1823244-05-8
CAS 1823244-05-8 appears in our catalog under these names: 4-(2-Formylfuran-3-yl)benzoic acid, 95%, 4-(2-Formylfuran-3-yl)benzoic acid, 97%, 4–(2–Formylfuran–3–yl)benzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
4-(2-formylfuran-3-yl)benzoic acid (CAS 1823244-05-8) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: 4-(2-formylfuran-3-yl)benzoic acid. InChIKey: FFRLLLWITZHGDQ-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-(2-formylfuran-3-yl)benzoic acid |
| InChIKey | FFRLLLWITZHGDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(OC=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)