CAS 39245-15-3 appears in our catalog under these names: 4-(5-Formyl-2-furyl)benzoic acid, 95%, 4-(5-Formylfuran-2-yl)benzoic acid, 95%, 95%, 4-(5-Formyl-furan-2-yl)-benzoic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(5-formylfuran-2-yl)benzoic acid (CAS 39245-15-3) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: 4-(5-formylfuran-2-yl)benzoic acid. InChIKey: LBIJVLPGGBXNPM-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-(5-formylfuran-2-yl)benzoic acid |
| InChIKey | LBIJVLPGGBXNPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C=O)C(=O)O |
Computed by PubChem (NCBI)