Products 2169-87-1
CAS 2169-87-1 appears in our catalog under these names: 2,3-Naphthalenedicarboxylic acid, 97%, 2,3-Naphthalenedicarboxylic Acid, 2，3–Naphthalenedicarboxylic Acid, 2,3-Naphthalenedicarboxylic Acid, >98.0%(GC)(T), Naphthalene-2,3-dicarboxylic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 2,5g, 250mg, 100g, 100mg.
Naphthalene-2,3-dicarboxylic acid (CAS 2169-87-1) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: naphthalene-2,3-dicarboxylic acid. InChIKey: KHARCSTZAGNHOT-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | naphthalene-2,3-dicarboxylic acid |
| InChIKey | KHARCSTZAGNHOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-Naphthalenedicarboxylic acid, 2,3-naphthalic acid, naphthalene-2,3-dicarboxylic acid, 2,3-Naphthalenedicarboxylicacid, 2,3-NDA; 2,3-Naphthalic Acid; NSC 16063; Naphthalene-2,3-carboxylic Acid, Naphthalin-2,3-dicarbonsure, ghl.PD_Mitscher_leg0.770, 2,3-Naphthalenedicarboxylic acid, 95%, 2,3-Naphthalenedicarboxylic Acid, inverted exclamation markO98%