cas: 934240-59-2 — see every product listed under this CAS number, including other names
1–((4–Bromophenoxy)methyl)–2–fluorobenzene (CAS 934240-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF47608-100mg |
| cas | 934240-59-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 751.50 Pln | |
| GLPBio | 1g | 1762.48 Pln | |
| GLPBio | 250mg | 957.44 Pln | |
| GLPBio | 5g | 3110.47 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-4-[(2-fluorophenyl)methoxy]benzene (CAS 934240-59-2) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-bromo-4-[(2-fluorophenyl)methoxy]benzene. InChIKey: XXRRODGDWJXPRI-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-bromo-4-[(2-fluorophenyl)methoxy]benzene |
| InChIKey | XXRRODGDWJXPRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)