CAS 242812-04-0 appears in our catalog under these names: 3-(2-Fluorophenoxy)benzyl bromide, 95%, 3-(2-Fluorophenoxy)benzyl Bromide. Offered by: Combi-blocks, TCI. Available pack sizes: 250mg, 100mg, 1g.
1-(bromomethyl)-3-(2-fluorophenoxy)benzene (CAS 242812-04-0) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-(bromomethyl)-3-(2-fluorophenoxy)benzene. InChIKey: FWAHWPGVFDHNCH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-(bromomethyl)-3-(2-fluorophenoxy)benzene |
| InChIKey | FWAHWPGVFDHNCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=CC(=C2)CBr)F |
Computed by PubChem (NCBI)