cas: 184763-07-3 — see every product listed under this CAS number, including other names
1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 95% (CAS 184763-07-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A922845-10g |
| cas | 184763-07-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12152.56 Pln | |
| AmBeed | 5g | 7257.04 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 184763-07-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-UHFFFAOYSA-N |
| SMILES | C1CN(C1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)