CAS 2340293-30-1 is the registry number for 2,5-Dioxopyrrolidin-1-yl 3,3-diphenylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 3,3-diphenylpropanoate (CAS 2340293-30-1) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3,3-diphenylpropanoate. InChIKey: YRHBAKNEAVKSSA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3,3-diphenylpropanoate |
| InChIKey | YRHBAKNEAVKSSA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CC(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)