cas: 64268-93-5 — see every product listed under this CAS number, including other names
1-((4-Nitrophenyl)sulfonyl)piperidine, 99% (CAS 64268-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212532-100MG |
| cas | 64268-93-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 1g | 6433.17 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-nitrophenyl)sulfonylpiperidine (CAS 64268-93-5) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfonylpiperidine. InChIKey: XDPAFNJUKBYWBZ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfonylpiperidine |
| InChIKey | XDPAFNJUKBYWBZ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)