cas: 64268-93-5 — see every product listed under this CAS number, including other names
1-[(4-Nitrophenyl)sulfonyl]piperidine (CAS 64268-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 50mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJ7U-100mg |
| cas | 64268-93-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 500mg | 338.00 Pln |
| delivery time | 3 weeks |
|---|
1-(4-nitrophenyl)sulfonylpiperidine (CAS 64268-93-5) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfonylpiperidine. InChIKey: XDPAFNJUKBYWBZ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfonylpiperidine |
| InChIKey | XDPAFNJUKBYWBZ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)