cas: 163229-48-9 — see every product listed under this CAS number, including other names
1-(1,1-Dimethylethyl) 2-methyl 1H-indole-1,2-dicarboxylate, 95%, 95% (CAS 163229-48-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TXN-100mg |
| cas | 163229-48-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 630.80 Pln | |
| Chemat | 5g | 1773.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate (CAS 163229-48-9) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate. InChIKey: UJVYYFYNECMKRA-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate |
| InChIKey | UJVYYFYNECMKRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1C(=O)OC |
Computed by PubChem (NCBI)