cas: 163229-48-9 — see every product listed under this CAS number, including other names
1-(tert-Butyl) 2-methyl 1H-indole-1,2-dicarboxylate, 97% (CAS 163229-48-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC27822CB |
| cas | 163229-48-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 151.20 Pln | |
| Thermo Scientific | 1g | 411.85 Pln | |
| Thermo Scientific | 5g | 1257.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate (CAS 163229-48-9) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate. InChIKey: UJVYYFYNECMKRA-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl indole-1,2-dicarboxylate |
| InChIKey | UJVYYFYNECMKRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1C(=O)OC |
Computed by PubChem (NCBI)