cas: 862574-89-8 — see every product listed under this CAS number, including other names
1-(1,3-Benzodioxol-5-yl)cyclopropanecarboxylic Acid, 97%, 97% (CAS 862574-89-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3V0-100mg |
| cas | 862574-89-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1139.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid (CAS 862574-89-8) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid. InChIKey: NZZVDTIYQUASAT-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclopropane-1-carboxylic acid |
| InChIKey | NZZVDTIYQUASAT-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)