cas: 107866-54-6 — see every product listed under this CAS number, including other names
1-(1H-[1,2,3]Triazolo[4,5-b]pyridin-1-yl)ethanone, 98%, 98% (CAS 107866-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DW8-100mg |
| cas | 107866-54-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 1936.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(triazolo[4,5-b]pyridin-1-yl)ethanone (CAS 107866-54-6) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 1-(triazolo[4,5-b]pyridin-1-yl)ethanone. InChIKey: SDYATKOQVBKTLQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1-(triazolo[4,5-b]pyridin-1-yl)ethanone |
| InChIKey | SDYATKOQVBKTLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(N=CC=C2)N=N1 |
Computed by PubChem (NCBI)