cas: 942853-22-7 — see every product listed under this CAS number, including other names
1-(2,2,2-Trifluoroethyl)-1H-pyrazole-3-carboxylic acid 95% (CAS 942853-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A225630-100mg |
| cas | 942853-22-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1694.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A225630 |
1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 942853-22-7) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: OJXAMYQOVDVCHO-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | OJXAMYQOVDVCHO-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)