CAS 942853-22-7 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-3-carboxylic acid, 98%, 1–(2,2,2–Trifluoroethyl)–1H–pyrazole–3–carboxylic acid, 1-(2,2,2-Trifluoroethyl)-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 942853-22-7) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: OJXAMYQOVDVCHO-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | OJXAMYQOVDVCHO-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1C(=O)O)CC(F)(F)F |
Computed by PubChem (NCBI)